C24H41NO2 — CID 2186
N-(2-hydroxyethyl)docosa-7,10,13,16-tetraenamide (PubChem CID 2186) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is N-(2-hydroxyethyl)docosa-7,10,13,16-tetraenamide.
| Compound Name | N-(2-hydroxyethyl)docosa-7,10,13,16-tetraenamide |
|---|---|
| PubChem CID | 2186 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | N-(2-hydroxyethyl)docosa-7,10,13,16-tetraenamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)NCCO |
| InChI | InChI=1S/C24H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(27)25-22-23-26/h6-7,9-10,12-13,15-16,26H,2-5,8,11,14,17-23H2,1H3,(H,25,27) |
| InChIKey | FMVHVRYFQIXOAF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|