C24H43NO6 — CID 154734676
(Z)-but-2-enedioic acid;(Z)-N-(2-hydroxyethyl)octadec-9-enamide (PubChem CID 154734676) has the molecular formula C24H43NO6 and a molecular weight of 441.61 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(Z)-N-(2-hydroxyethyl)octadec-9-enamide.
| Compound Name | (Z)-but-2-enedioic acid;(Z)-N-(2-hydroxyethyl)octadec-9-enamide |
|---|---|
| PubChem CID | 154734676 |
| Molecular Formula | C24H43NO6 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | (Z)-but-2-enedioic acid;(Z)-N-(2-hydroxyethyl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCO.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H39NO2.C4H4O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22;5-3(6)1-2-4(7)8/h9-10,22H,2-8,11-19H2,1H3,(H,21,23);1-2H,(H,5,6)(H,7,8)/b10-9-;2-1- |
| InChIKey | HOTJHMUERWBCEI-HCOBDNFMSA-N |
| XLogP | 4.84 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|