About acetic acid;N-propyloctadec-9-enamide
acetic acid;N-propyloctadec-9-enamide (PubChem CID 173298738) has the molecular formula C23H45NO3
and a molecular weight of 383.62 g/mol. Its IUPAC name is acetic acid;N-propyloctadec-9-enamide.
Molecular Properties
| Compound Name | acetic acid;N-propyloctadec-9-enamide |
| PubChem CID | 173298738 |
| Molecular Formula | C23H45NO3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.34 |
| IUPAC Name | acetic acid;N-propyloctadec-9-enamide |
| SMILES | CC(=O)O.CCCCCCCCC=CCCCCCCCC(=O)NCCC |
| InChI | InChI=1S/C21H41NO.C2H4O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)22-20-4-2;1-2(3)4/h11-12H,3-10,13-20H2,1-2H3,(H,22,23);1H3,(H,3,4) |
| InChIKey | IVLVDKPOPJIVFM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;N-propyloctadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;N-propyloctadec-9-enamide?
The IUPAC name of acetic acid;N-propyloctadec-9-enamide (CID 173298738) is acetic acid;N-propyloctadec-9-enamide.
What is the SMILES notation for acetic acid;N-propyloctadec-9-enamide?
The canonical SMILES for acetic acid;N-propyloctadec-9-enamide is CC(=O)O.CCCCCCCCC=CCCCCCCCC(=O)NCCC.
What is the InChIKey of acetic acid;N-propyloctadec-9-enamide?
The InChIKey is IVLVDKPOPJIVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41NO.C2H4O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)22-20-4-2;1-2(3)4/h11-12H,3-10,13-20H2,1-2H3,(H,22,23);1H3,(H,3,4).
What are the key properties of acetic acid;N-propyloctadec-9-enamide?
acetic acid;N-propyloctadec-9-enamide has a molecular weight of 383.62 g/mol, XLogP of 6.64, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N-propyloctadec-9-enamide is sourced from PubChem (CID 173298738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).