C22H39NO2 — CID 4029
N-(2-hydroxyethyl)icosa-5,8,11-trienamide (PubChem CID 4029) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is N-(2-hydroxyethyl)icosa-5,8,11-trienamide.
| Compound Name | N-(2-hydroxyethyl)icosa-5,8,11-trienamide |
|---|---|
| PubChem CID | 4029 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | N-(2-hydroxyethyl)icosa-5,8,11-trienamide |
| SMILES | CCCCCCCCC=CCC=CCC=CCCCC(=O)NCCO |
| InChI | InChI=1S/C22H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h9-10,12-13,15-16,24H,2-8,11,14,17-21H2,1H3,(H,23,25) |
| InChIKey | YKGQBEGMUSSPFY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|