C23H43NO2 — CID 169175675
(3Z,6Z)-dodeca-3,6-diene;(Z)-N-(2-hydroxyethyl)-7-methyloct-5-enamide (PubChem CID 169175675) has the molecular formula C23H43NO2 and a molecular weight of 365.60 g/mol. Its IUPAC name is (3Z,6Z)-dodeca-3,6-diene;(Z)-N-(2-hydroxyethyl)-7-methyloct-5-enamide.
| Compound Name | (3Z,6Z)-dodeca-3,6-diene;(Z)-N-(2-hydroxyethyl)-7-methyloct-5-enamide |
|---|---|
| PubChem CID | 169175675 |
| Molecular Formula | C23H43NO2 |
| Molecular Weight | 365.60 g/mol |
| Exact Mass | 365.33 |
| IUPAC Name | (3Z,6Z)-dodeca-3,6-diene;(Z)-N-(2-hydroxyethyl)-7-methyloct-5-enamide |
| SMILES | CC(C)/C=C\CCCC(=O)NCCO.CC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C12H22.C11H21NO2/c1-3-5-7-9-11-12-10-8-6-4-2;1-10(2)6-4-3-5-7-11(14)12-8-9-13/h5,7,11-12H,3-4,6,8-10H2,1-2H3;4,6,10,13H,3,5,7-9H2,1-2H3,(H,12,14)/b7-5-,12-11-;6-4- |
| InChIKey | UIZRAKYXGOJXKM-MUANLGRBSA-N |
| XLogP | 5.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|