C22H36ClNO — CID 1977
N-(2-chloroethyl)icosa-5,8,11,14-tetraenamide (PubChem CID 1977) has the molecular formula C22H36ClNO and a molecular weight of 365.99 g/mol. Its IUPAC name is N-(2-chloroethyl)icosa-5,8,11,14-tetraenamide.
| Compound Name | N-(2-chloroethyl)icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 1977 |
| Molecular Formula | C22H36ClNO |
| Molecular Weight | 365.99 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | N-(2-chloroethyl)icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NCCCl |
| InChI | InChI=1S/C22H36ClNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)24-21-20-23/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-21H2,1H3,(H,24,25) |
| InChIKey | SCJNCDSAIRBRIA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.99 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|