C44H83N5O2 — CID 57356255
N-[2-[2-[2-[2-(octadeca-9,12-dienoylamino)ethylamino]ethylamino]ethylamino]ethyl]octadeca-9,12-dienamide (PubChem CID 57356255) has the molecular formula C44H83N5O2 and a molecular weight of 714.18 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(octadeca-9,12-dienoylamino)ethylamino]ethylamino]ethylamino]ethyl]octadeca-9,12-dienamide.
| Compound Name | N-[2-[2-[2-[2-(octadeca-9,12-dienoylamino)ethylamino]ethylamino]ethylamino]ethyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 57356255 |
| Molecular Formula | C44H83N5O2 |
| Molecular Weight | 714.18 g/mol |
| Exact Mass | 713.65 |
| IUPAC Name | N-[2-[2-[2-[2-(octadeca-9,12-dienoylamino)ethylamino]ethylamino]ethylamino]ethyl]octadeca-9,12-dienamide |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NCCNCCNCCNCCNC(=O)CCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C44H83N5O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-43(50)48-41-39-46-37-35-45-36-38-47-40-42-49-44(51)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,45-47H,3-10,15-16,21-42H2,1-2H3,(H,48,50)(H,49,51) |
| InChIKey | VKQJCYCXUGUKQJ-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.18 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|