C37H66N2O2 — CID 54300441
N-[(octadeca-9,12-dienoylamino)methyl]octadeca-9,12-dienamide (PubChem CID 54300441) has the molecular formula C37H66N2O2 and a molecular weight of 570.95 g/mol. Its IUPAC name is N-[(octadeca-9,12-dienoylamino)methyl]octadeca-9,12-dienamide.
| Compound Name | N-[(octadeca-9,12-dienoylamino)methyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 54300441 |
| Molecular Formula | C37H66N2O2 |
| Molecular Weight | 570.95 g/mol |
| Exact Mass | 570.51 |
| IUPAC Name | N-[(octadeca-9,12-dienoylamino)methyl]octadeca-9,12-dienamide |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NCNC(=O)CCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C37H66N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36(40)38-35-39-37(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20H,3-10,15-16,21-35H2,1-2H3,(H,38,40)(H,39,41) |
| InChIKey | SDUNCQFMANYVJV-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.95 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|