C24H44N2O2 — CID 101279958
N,N'-bis[(E)-non-2-enyl]hexanediamide (PubChem CID 101279958) has the molecular formula C24H44N2O2 and a molecular weight of 392.63 g/mol. Its IUPAC name is N,N'-bis[(E)-non-2-enyl]hexanediamide.
| Compound Name | N,N'-bis[(E)-non-2-enyl]hexanediamide |
|---|---|
| PubChem CID | 101279958 |
| Molecular Formula | C24H44N2O2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | N,N'-bis[(E)-non-2-enyl]hexanediamide |
| SMILES | CCCCCC/C=C/CNC(=O)CCCCC(=O)NC/C=C/CCCCCC |
| InChI | InChI=1S/C24H44N2O2/c1-3-5-7-9-11-13-17-21-25-23(27)19-15-16-20-24(28)26-22-18-14-12-10-8-6-4-2/h13-14,17-18H,3-12,15-16,19-22H2,1-2H3,(H,25,27)(H,26,28)/b17-13+,18-14+ |
| InChIKey | FCJDSENAVPDJJN-HBKJEHTGSA-N |
| XLogP | 5.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|