C26H53N5O — CID 6366313
(9E,12E)-N-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]octadeca-9,12-dienamide (PubChem CID 6366313) has the molecular formula C26H53N5O and a molecular weight of 451.74 g/mol. Its IUPAC name is (9E,12E)-N-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]octadeca-9,12-dienamide.
| Compound Name | (9E,12E)-N-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 6366313 |
| Molecular Formula | C26H53N5O |
| Molecular Weight | 451.74 g/mol |
| Exact Mass | 451.43 |
| IUPAC Name | (9E,12E)-N-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethyl]octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)NCCNCCNCCNCCN |
| InChI | InChI=1S/C26H53N5O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(32)31-25-24-30-23-22-29-21-20-28-19-18-27/h6-7,9-10,28-30H,2-5,8,11-25,27H2,1H3,(H,31,32)/b7-6+,10-9+ |
| InChIKey | IGTHUKCHFWQYHW-AVQMFFATSA-N |
| XLogP | 3.64 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.74 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|