About N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide
N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide (PubChem CID 175205777) has the molecular formula C16H37Br2N3O
and a molecular weight of 447.30 g/mol. Its IUPAC name is N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide.
Molecular Properties
| Compound Name | N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide |
| PubChem CID | 175205777 |
| Molecular Formula | C16H37Br2N3O |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide |
| SMILES | Br.Br.CCCCCCCCCCCC(=O)NCCNCCN |
| InChI | InChI=1S/C16H35N3O.2BrH/c1-2-3-4-5-6-7-8-9-10-11-16(20)19-15-14-18-13-12-17;;/h18H,2-15,17H2,1H3,(H,19,20);2*1H |
| InChIKey | DURIYVXSUYWDGJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide?
The IUPAC name of N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide (CID 175205777) is N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide.
What is the SMILES notation for N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide?
The canonical SMILES for N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide is Br.Br.CCCCCCCCCCCC(=O)NCCNCCN.
What is the InChIKey of N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide?
The InChIKey is DURIYVXSUYWDGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35N3O.2BrH/c1-2-3-4-5-6-7-8-9-10-11-16(20)19-15-14-18-13-12-17;;/h18H,2-15,17H2,1H3,(H,19,20);2*1H.
What are the key properties of N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide?
N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide has a molecular weight of 447.30 g/mol, XLogP of 3.73, 15 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-aminoethylamino)ethyl]dodecanamide;dihydrobromide is sourced from PubChem (CID 175205777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).