C24H48N4O — CID 3023011
N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]octadeca-9,12-dienamide (PubChem CID 3023011) has the molecular formula C24H48N4O and a molecular weight of 408.68 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]octadeca-9,12-dienamide.
| Compound Name | N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 3023011 |
| Molecular Formula | C24H48N4O |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | N-[2-[2-(2-aminoethylamino)ethylamino]ethyl]octadeca-9,12-dienamide |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NCCNCCNCCN |
| InChI | InChI=1S/C24H48N4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(29)28-23-22-27-21-20-26-19-18-25/h6-7,9-10,26-27H,2-5,8,11-23,25H2,1H3,(H,28,29) |
| InChIKey | ZOHQBCHYQPFLNG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|