C28H58N4O — CID 10819608
(Z)-N-[3-[4-(3-aminopropylamino)butylamino]propyl]octadec-9-enamide (PubChem CID 10819608) has the molecular formula C28H58N4O and a molecular weight of 466.80 g/mol. Its IUPAC name is (Z)-N-[3-[4-(3-aminopropylamino)butylamino]propyl]octadec-9-enamide.
| Compound Name | (Z)-N-[3-[4-(3-aminopropylamino)butylamino]propyl]octadec-9-enamide |
|---|---|
| PubChem CID | 10819608 |
| Molecular Formula | C28H58N4O |
| Molecular Weight | 466.80 g/mol |
| Exact Mass | 466.46 |
| IUPAC Name | (Z)-N-[3-[4-(3-aminopropylamino)butylamino]propyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C28H58N4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-28(33)32-27-20-26-31-24-18-17-23-30-25-19-22-29/h9-10,30-31H,2-8,11-27,29H2,1H3,(H,32,33)/b10-9- |
| InChIKey | MLKSKAFQVXZZBV-KTKRTIGZSA-N |
| XLogP | 5.84 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.80 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|