C48H92N2O2 — CID 149363238
(Z)-N-[3-[[(Z)-10-oxoheptacos-18-enyl]amino]propyl]octadec-9-enamide (PubChem CID 149363238) has the molecular formula C48H92N2O2 and a molecular weight of 729.28 g/mol. Its IUPAC name is (Z)-N-[3-[[(Z)-10-oxoheptacos-18-enyl]amino]propyl]octadec-9-enamide.
| Compound Name | (Z)-N-[3-[[(Z)-10-oxoheptacos-18-enyl]amino]propyl]octadec-9-enamide |
|---|---|
| PubChem CID | 149363238 |
| Molecular Formula | C48H92N2O2 |
| Molecular Weight | 729.28 g/mol |
| Exact Mass | 728.72 |
| IUPAC Name | (Z)-N-[3-[[(Z)-10-oxoheptacos-18-enyl]amino]propyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)CCCCCCCCCNCCCNC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C48H92N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-28-32-36-41-47(51)42-37-33-29-27-31-35-39-44-49-45-40-46-50-48(52)43-38-34-30-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,49H,3-16,21-46H2,1-2H3,(H,50,52)/b19-17-,20-18- |
| InChIKey | YIHYVXSIWOTVBD-CLFAGFIQSA-N |
| XLogP | 14.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.28 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|