C40H80N2O3 — CID 174758491
N-(2-aminoethyl)hexadecanamide;(Z)-docos-13-enoic acid (PubChem CID 174758491) has the molecular formula C40H80N2O3 and a molecular weight of 637.09 g/mol. Its IUPAC name is N-(2-aminoethyl)hexadecanamide;(Z)-docos-13-enoic acid.
| Compound Name | N-(2-aminoethyl)hexadecanamide;(Z)-docos-13-enoic acid |
|---|---|
| PubChem CID | 174758491 |
| Molecular Formula | C40H80N2O3 |
| Molecular Weight | 637.09 g/mol |
| Exact Mass | 636.62 |
| IUPAC Name | N-(2-aminoethyl)hexadecanamide;(Z)-docos-13-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCCC(=O)NCCN |
| InChI | InChI=1S/C22H42O2.C18H38N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)20-17-16-19/h9-10H,2-8,11-21H2,1H3,(H,23,24);2-17,19H2,1H3,(H,20,21)/b10-9-; |
| InChIKey | UKMYIGJYYNETNE-KVVVOXFISA-N |
| XLogP | 12.21 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.09 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|