C22H47N3O2 — CID 6441410
N'-(2-aminoethyl)ethane-1,2-diamine;(Z)-octadec-9-enoic acid (PubChem CID 6441410) has the molecular formula C22H47N3O2 and a molecular weight of 385.64 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;(Z)-octadec-9-enoic acid.
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 6441410 |
| Molecular Formula | C22H47N3O2 |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.37 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.NCCNCCN |
| InChI | InChI=1S/C18H34O2.C4H13N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);7H,1-6H2/b10-9-; |
| InChIKey | PYBPYUAKCDQFCS-KVVVOXFISA-N |
| XLogP | 4.60 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|