docos-14-enoic acid

C22H42O2 — CID 54090186

IUPACdocos-14-enoic acid
SMILESCCCCCCCC=CCCCCCCCCCCCCC(=O)O
InChIInChI=1S/C22H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h8-9H,2-7,10-21H2,1H3,(H,23,24)
InChIKeyMTHLEQRYTJWJKJ-UHFFFAOYSA-N
MW338.58 g/mol
LogP7.67
Rot. Bonds19

About docos-14-enoic acid

docos-14-enoic acid (PubChem CID 54090186) has the molecular formula C22H42O2 and a molecular weight of 338.58 g/mol. Its IUPAC name is docos-14-enoic acid.

Molecular Properties

Compound Namedocos-14-enoic acid
PubChem CID54090186
Molecular FormulaC22H42O2
Molecular Weight338.58 g/mol
Exact Mass338.32
IUPAC Namedocos-14-enoic acid
SMILESCCCCCCCC=CCCCCCCCCCCCCC(=O)O
InChIInChI=1S/C22H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h8-9H,2-7,10-21H2,1H3,(H,23,24)
InChIKeyMTHLEQRYTJWJKJ-UHFFFAOYSA-N
XLogP7.67
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds19
Heavy Atoms24
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500338.58
LogP ≤ 57.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze docos-14-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of docos-14-enoic acid?
The IUPAC name of docos-14-enoic acid (CID 54090186) is docos-14-enoic acid.
What is the SMILES notation for docos-14-enoic acid?
The canonical SMILES for docos-14-enoic acid is CCCCCCCC=CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of docos-14-enoic acid?
The InChIKey is MTHLEQRYTJWJKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h8-9H,2-7,10-21H2,1H3,(H,23,24).
What are the key properties of docos-14-enoic acid?
docos-14-enoic acid has a molecular weight of 338.58 g/mol, XLogP of 7.67, 19 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for docos-14-enoic acid is sourced from PubChem (CID 54090186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).