About docos-14-enoic acid
docos-14-enoic acid (PubChem CID 54090186) has the molecular formula C22H42O2
and a molecular weight of 338.58 g/mol. Its IUPAC name is docos-14-enoic acid.
Molecular Properties
| Compound Name | docos-14-enoic acid |
| PubChem CID | 54090186 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | docos-14-enoic acid |
| SMILES | CCCCCCCC=CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h8-9H,2-7,10-21H2,1H3,(H,23,24) |
| InChIKey | MTHLEQRYTJWJKJ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze docos-14-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docos-14-enoic acid?
The IUPAC name of docos-14-enoic acid (CID 54090186) is docos-14-enoic acid.
What is the SMILES notation for docos-14-enoic acid?
The canonical SMILES for docos-14-enoic acid is CCCCCCCC=CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of docos-14-enoic acid?
The InChIKey is MTHLEQRYTJWJKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h8-9H,2-7,10-21H2,1H3,(H,23,24).
What are the key properties of docos-14-enoic acid?
docos-14-enoic acid has a molecular weight of 338.58 g/mol, XLogP of 7.67, 19 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for docos-14-enoic acid is sourced from PubChem (CID 54090186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).