C16H34N2O7 — CID 161257212
acetic acid;N-(2-aminoethyl)octanamide (PubChem CID 161257212) has the molecular formula C16H34N2O7 and a molecular weight of 366.46 g/mol. Its IUPAC name is acetic acid;N-(2-aminoethyl)octanamide.
| Compound Name | acetic acid;N-(2-aminoethyl)octanamide |
|---|---|
| PubChem CID | 161257212 |
| Molecular Formula | C16H34N2O7 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | acetic acid;N-(2-aminoethyl)octanamide |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CCCCCCCC(=O)NCCN |
| InChI | InChI=1S/C10H22N2O.3C2H4O2/c1-2-3-4-5-6-7-10(13)12-9-8-11;3*1-2(3)4/h2-9,11H2,1H3,(H,12,13);3*1H3,(H,3,4) |
| InChIKey | VCBSMZIQJVUAQS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|