C40H82N4O2 — CID 58975602
N,N'-bis(2-aminoethyl)-10,11-dioctylicosanediamide (PubChem CID 58975602) has the molecular formula C40H82N4O2 and a molecular weight of 651.12 g/mol. Its IUPAC name is N,N'-bis(2-aminoethyl)-10,11-dioctylicosanediamide.
| Compound Name | N,N'-bis(2-aminoethyl)-10,11-dioctylicosanediamide |
|---|---|
| PubChem CID | 58975602 |
| Molecular Formula | C40H82N4O2 |
| Molecular Weight | 651.12 g/mol |
| Exact Mass | 650.64 |
| IUPAC Name | N,N'-bis(2-aminoethyl)-10,11-dioctylicosanediamide |
| SMILES | CCCCCCCCC(CCCCCCCCC(=O)NCCN)C(CCCCCCCC)CCCCCCCCC(=O)NCCN |
| InChI | InChI=1S/C40H82N4O2/c1-3-5-7-9-15-21-27-37(29-23-17-11-13-19-25-31-39(45)43-35-33-41)38(28-22-16-10-8-6-4-2)30-24-18-12-14-20-26-32-40(46)44-36-34-42/h37-38H,3-36,41-42H2,1-2H3,(H,43,45)(H,44,46) |
| InChIKey | WQBMEXXVBBWCKK-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.12 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|