C23H39NOS — CID 137455017
(5E,8E,11E,14E)-N-(3-sulfanylpropyl)icosa-5,8,11,14-tetraenamide (PubChem CID 137455017) has the molecular formula C23H39NOS and a molecular weight of 377.64 g/mol. Its IUPAC name is (5E,8E,11E,14E)-N-(3-sulfanylpropyl)icosa-5,8,11,14-tetraenamide.
| Compound Name | (5E,8E,11E,14E)-N-(3-sulfanylpropyl)icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 137455017 |
| Molecular Formula | C23H39NOS |
| Molecular Weight | 377.64 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | (5E,8E,11E,14E)-N-(3-sulfanylpropyl)icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)NCCCS |
| InChI | InChI=1S/C23H39NOS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(25)24-21-19-22-26/h6-7,9-10,12-13,15-16,26H,2-5,8,11,14,17-22H2,1H3,(H,24,25)/b7-6+,10-9+,13-12+,16-15+ |
| InChIKey | LNVVWFSESOKAMB-CGRWFSSPSA-N |
| XLogP | 6.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.64 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|