C24H42N2O — CID 90799931
N-[2-(dimethylamino)ethyl]icosa-5,8,11,14-tetraenamide (PubChem CID 90799931) has the molecular formula C24H42N2O and a molecular weight of 374.61 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]icosa-5,8,11,14-tetraenamide.
| Compound Name | N-[2-(dimethylamino)ethyl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 90799931 |
| Molecular Formula | C24H42N2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)NCCN(C)C |
| InChI | InChI=1S/C24H42N2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(27)25-22-23-26(2)3/h8-9,11-12,14-15,17-18H,4-7,10,13,16,19-23H2,1-3H3,(H,25,27) |
| InChIKey | BQLRDSSIHLJBIT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|