C60H114N4O3 — CID 85077312
N-[2-[bis[2-(octadec-9-enoylamino)ethyl]amino]ethyl]octadec-9-enamide (PubChem CID 85077312) has the molecular formula C60H114N4O3 and a molecular weight of 939.60 g/mol. Its IUPAC name is N-[2-[bis[2-(octadec-9-enoylamino)ethyl]amino]ethyl]octadec-9-enamide.
| Compound Name | N-[2-[bis[2-(octadec-9-enoylamino)ethyl]amino]ethyl]octadec-9-enamide |
|---|---|
| PubChem CID | 85077312 |
| Molecular Formula | C60H114N4O3 |
| Molecular Weight | 939.60 g/mol |
| Exact Mass | 938.89 |
| IUPAC Name | N-[2-[bis[2-(octadec-9-enoylamino)ethyl]amino]ethyl]octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCN(CCNC(=O)CCCCCCCC=CCCCCCCCC)CCNC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C60H114N4O3/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-58(65)61-52-55-64(56-53-62-59(66)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)57-54-63-60(67)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h25-30H,4-24,31-57H2,1-3H3,(H,61,65)(H,62,66)(H,63,67) |
| InChIKey | XZZPMNWCCJTAFH-UHFFFAOYSA-N |
| XLogP | 16.75 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.60 |
| LogP ≤ 5 | 16.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|