C24H48N2O2 — CID 6437128
(E)-N-[2-[ethyl(2-hydroxyethyl)amino]ethyl]octadec-9-enamide (PubChem CID 6437128) has the molecular formula C24H48N2O2 and a molecular weight of 396.66 g/mol. Its IUPAC name is (E)-N-[2-[ethyl(2-hydroxyethyl)amino]ethyl]octadec-9-enamide.
| Compound Name | (E)-N-[2-[ethyl(2-hydroxyethyl)amino]ethyl]octadec-9-enamide |
|---|---|
| PubChem CID | 6437128 |
| Molecular Formula | C24H48N2O2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.37 |
| IUPAC Name | (E)-N-[2-[ethyl(2-hydroxyethyl)amino]ethyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)NCCN(CC)CCO |
| InChI | InChI=1S/C24H48N2O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(28)25-20-21-26(4-2)22-23-27/h11-12,27H,3-10,13-23H2,1-2H3,(H,25,28)/b12-11+ |
| InChIKey | KLQRKYZWLSWRCA-VAWYXSNFSA-N |
| XLogP | 5.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|