C21H42N2O2 — CID 101274880
(E)-N-[2-[ethyl(9-hydroxynonyl)amino]ethyl]oct-4-enamide (PubChem CID 101274880) has the molecular formula C21H42N2O2 and a molecular weight of 354.58 g/mol. Its IUPAC name is (E)-N-[2-[ethyl(9-hydroxynonyl)amino]ethyl]oct-4-enamide.
| Compound Name | (E)-N-[2-[ethyl(9-hydroxynonyl)amino]ethyl]oct-4-enamide |
|---|---|
| PubChem CID | 101274880 |
| Molecular Formula | C21H42N2O2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.32 |
| IUPAC Name | (E)-N-[2-[ethyl(9-hydroxynonyl)amino]ethyl]oct-4-enamide |
| SMILES | CCC/C=C/CCC(=O)NCCN(CC)CCCCCCCCCO |
| InChI | InChI=1S/C21H42N2O2/c1-3-5-6-10-13-16-21(25)22-17-19-23(4-2)18-14-11-8-7-9-12-15-20-24/h6,10,24H,3-5,7-9,11-20H2,1-2H3,(H,22,25)/b10-6+ |
| InChIKey | VXCQRLBUIDNVSV-UXBLZVDNSA-N |
| XLogP | 4.28 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|