C19H38N2O2 — CID 101274768
(E)-N-[[ethyl(9-hydroxynonyl)amino]methyl]hept-5-enamide (PubChem CID 101274768) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is (E)-N-[[ethyl(9-hydroxynonyl)amino]methyl]hept-5-enamide.
| Compound Name | (E)-N-[[ethyl(9-hydroxynonyl)amino]methyl]hept-5-enamide |
|---|---|
| PubChem CID | 101274768 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | (E)-N-[[ethyl(9-hydroxynonyl)amino]methyl]hept-5-enamide |
| SMILES | C/C=C/CCCC(=O)NCN(CC)CCCCCCCCCO |
| InChI | InChI=1S/C19H38N2O2/c1-3-5-6-12-15-19(23)20-18-21(4-2)16-13-10-8-7-9-11-14-17-22/h3,5,22H,4,6-18H2,1-2H3,(H,20,23)/b5-3+ |
| InChIKey | KIWWNDZUDAVHML-HWKANZROSA-N |
| XLogP | 3.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|