C51H99NO5 — CID 174355599
7-[6-[(E)-2-hexyldec-8-enoyl]oxyhexyl-(6-hydroxyhexyl)amino]heptyl 2-hexyldecanoate (PubChem CID 174355599) has the molecular formula C51H99NO5 and a molecular weight of 806.35 g/mol. Its IUPAC name is 7-[6-[(E)-2-hexyldec-8-enoyl]oxyhexyl-(6-hydroxyhexyl)amino]heptyl 2-hexyldecanoate.
| Compound Name | 7-[6-[(E)-2-hexyldec-8-enoyl]oxyhexyl-(6-hydroxyhexyl)amino]heptyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 174355599 |
| Molecular Formula | C51H99NO5 |
| Molecular Weight | 806.35 g/mol |
| Exact Mass | 805.75 |
| IUPAC Name | 7-[6-[(E)-2-hexyldec-8-enoyl]oxyhexyl-(6-hydroxyhexyl)amino]heptyl 2-hexyldecanoate |
| SMILES | C/C=C/CCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCCCCO)CCCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C51H99NO5/c1-5-9-13-17-20-30-40-48(38-28-15-11-7-3)50(54)56-46-36-26-19-22-32-42-52(43-33-23-25-35-45-53)44-34-24-27-37-47-57-51(55)49(39-29-16-12-8-4)41-31-21-18-14-10-6-2/h6,10,48-49,53H,5,7-9,11-47H2,1-4H3/b10-6+ |
| InChIKey | VHWLJBJBBGYABV-UXBLZVDNSA-N |
| XLogP | 14.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.35 |
| LogP ≤ 5 | 14.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|