C43H87NO5 — CID 170743016
6-[4-hydroxybutyl-[6-(1-propoxyoctoxy)hexyl]amino]hexyl 2-hexyldecanoate (PubChem CID 170743016) has the molecular formula C43H87NO5 and a molecular weight of 698.17 g/mol. Its IUPAC name is 6-[4-hydroxybutyl-[6-(1-propoxyoctoxy)hexyl]amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[4-hydroxybutyl-[6-(1-propoxyoctoxy)hexyl]amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 170743016 |
| Molecular Formula | C43H87NO5 |
| Molecular Weight | 698.17 g/mol |
| Exact Mass | 697.66 |
| IUPAC Name | 6-[4-hydroxybutyl-[6-(1-propoxyoctoxy)hexyl]amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCCO)CCCCCCOC(CCCCCCC)OCCC |
| InChI | InChI=1S/C43H87NO5/c1-5-9-12-15-17-23-32-41(31-22-14-11-7-3)43(46)49-40-30-21-19-26-35-44(36-27-28-37-45)34-25-18-20-29-39-48-42(47-38-8-4)33-24-16-13-10-6-2/h41-42,45H,5-40H2,1-4H3 |
| InChIKey | QGLMFEUEOAXJDX-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.17 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|