C98H202N2O12Si2 — CID 175993039
6-[6-[dimethyl(1-octoxyheptoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate (PubChem CID 175993039) has the molecular formula C98H202N2O12Si2 and a molecular weight of 1656.87 g/mol. Its IUPAC name is 6-[6-[dimethyl(1-octoxyheptoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[6-[dimethyl(1-octoxyheptoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 175993039 |
| Molecular Formula | C98H202N2O12Si2 |
| Molecular Weight | 1656.87 g/mol |
| Exact Mass | 1655.48 |
| IUPAC Name | 6-[6-[dimethyl(1-octoxyheptoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCOC(CCCCCC)O[Si](C)(C)OCCCCCCN(CCCCO)CCCCCCOC(=O)C(CCCCCC)CCCCCCCC.CCCCCCCCOC(CCCCCC)O[Si](C)(C)OCCCCCCN(CCCCO)CCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/2C49H101NO6Si/c2*1-7-11-15-19-21-28-38-47(37-27-17-13-9-3)49(52)54-45-35-25-22-30-40-50(42-32-33-43-51)41-31-23-26-36-46-55-57(5,6)56-48(39-29-18-14-10-4)53-44-34-24-20-16-12-8-2/h2*47-48,51H,7-46H2,1-6H3 |
| InChIKey | OKRPUCTZELTSBY-UHFFFAOYSA-N |
| XLogP | 28.94 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 94 |
| Heavy Atoms | 114 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1656.87 |
| LogP ≤ 5 | 28.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|