C50H99NO5 — CID 137396856
6-[6-[(2S)-2-hexyldecanoyl]oxyhexyl-(6-hydroxyhexyl)amino]hexyl 2-hexyldecanoate (PubChem CID 137396856) has the molecular formula C50H99NO5 and a molecular weight of 794.34 g/mol. Its IUPAC name is 6-[6-[(2S)-2-hexyldecanoyl]oxyhexyl-(6-hydroxyhexyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[6-[(2S)-2-hexyldecanoyl]oxyhexyl-(6-hydroxyhexyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 137396856 |
| Molecular Formula | C50H99NO5 |
| Molecular Weight | 794.34 g/mol |
| Exact Mass | 793.75 |
| IUPAC Name | 6-[6-[(2S)-2-hexyldecanoyl]oxyhexyl-(6-hydroxyhexyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCCCCO)CCCCCCOC(=O)[C@@H](CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C50H99NO5/c1-5-9-13-17-19-29-39-47(37-27-15-11-7-3)49(53)55-45-35-25-22-32-42-51(41-31-21-24-34-44-52)43-33-23-26-36-46-56-50(54)48(38-28-16-12-8-4)40-30-20-18-14-10-6-2/h47-48,52H,5-46H2,1-4H3/t47-,48?/m0/s1 |
| InChIKey | JLOLGUTUIOGAFX-FMDAZQDHSA-N |
| XLogP | 14.72 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.34 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|