C34H67NO5 — CID 171808087
6-[6-formyloxyhexyl(5-hydroxypentyl)amino]hexyl 2-hexyldecanoate (PubChem CID 171808087) has the molecular formula C34H67NO5 and a molecular weight of 569.91 g/mol. Its IUPAC name is 6-[6-formyloxyhexyl(5-hydroxypentyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[6-formyloxyhexyl(5-hydroxypentyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 171808087 |
| Molecular Formula | C34H67NO5 |
| Molecular Weight | 569.91 g/mol |
| Exact Mass | 569.50 |
| IUPAC Name | 6-[6-formyloxyhexyl(5-hydroxypentyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCCCO)CCCCCCOC=O |
| InChI | InChI=1S/C34H67NO5/c1-3-5-7-9-10-17-25-33(24-16-8-6-4-2)34(38)40-31-23-14-12-19-27-35(28-20-15-21-29-36)26-18-11-13-22-30-39-32-37/h32-33,36H,3-31H2,1-2H3 |
| InChIKey | XTUAFZHYVIIPDG-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.91 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|