C45H91NO5 — CID 170567542
4-[4-(2-butyldecanoyloxy)butyl-(4-hydroxybutyl)amino]butyl 2-hexyldecanoate;propane (PubChem CID 170567542) has the molecular formula C45H91NO5 and a molecular weight of 726.22 g/mol. Its IUPAC name is 4-[4-(2-butyldecanoyloxy)butyl-(4-hydroxybutyl)amino]butyl 2-hexyldecanoate;propane.
| Compound Name | 4-[4-(2-butyldecanoyloxy)butyl-(4-hydroxybutyl)amino]butyl 2-hexyldecanoate;propane |
|---|---|
| PubChem CID | 170567542 |
| Molecular Formula | C45H91NO5 |
| Molecular Weight | 726.22 g/mol |
| Exact Mass | 725.69 |
| IUPAC Name | 4-[4-(2-butyldecanoyloxy)butyl-(4-hydroxybutyl)amino]butyl 2-hexyldecanoate;propane |
| SMILES | CCC.CCCCCCCCC(CCCC)C(=O)OCCCCN(CCCCO)CCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C42H83NO5.C3H8/c1-5-9-13-16-18-21-31-39(29-12-8-4)41(45)47-37-27-24-34-43(33-23-26-36-44)35-25-28-38-48-42(46)40(30-20-15-11-7-3)32-22-19-17-14-10-6-2;1-3-2/h39-40,44H,5-38H2,1-4H3;3H2,1-2H3 |
| InChIKey | UZEBXEBLMRZYGD-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.22 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|