C39H76BrNO4 — CID 168955496
6-[3-bromopropyl-[6-(2-butyloctanoyloxy)hexyl]amino]hexyl 2-butyloctanoate (PubChem CID 168955496) has the molecular formula C39H76BrNO4 and a molecular weight of 702.94 g/mol. Its IUPAC name is 6-[3-bromopropyl-[6-(2-butyloctanoyloxy)hexyl]amino]hexyl 2-butyloctanoate.
| Compound Name | 6-[3-bromopropyl-[6-(2-butyloctanoyloxy)hexyl]amino]hexyl 2-butyloctanoate |
|---|---|
| PubChem CID | 168955496 |
| Molecular Formula | C39H76BrNO4 |
| Molecular Weight | 702.94 g/mol |
| Exact Mass | 701.50 |
| IUPAC Name | 6-[3-bromopropyl-[6-(2-butyloctanoyloxy)hexyl]amino]hexyl 2-butyloctanoate |
| SMILES | CCCCCCC(CCCC)C(=O)OCCCCCCN(CCCBr)CCCCCCOC(=O)C(CCCC)CCCCCC |
| InChI | InChI=1S/C39H76BrNO4/c1-5-9-13-19-28-36(26-11-7-3)38(42)44-34-23-17-15-21-31-41(33-25-30-40)32-22-16-18-24-35-45-39(43)37(27-12-8-4)29-20-14-10-6-2/h36-37H,5-35H2,1-4H3 |
| InChIKey | DFRNJZWKKPIDAW-UHFFFAOYSA-N |
| XLogP | 11.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.94 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|