C105H207N3O8 — CID 166047667
9-[2-[2-[bis[9-(2-hexyldecanoyloxy)nonyl]amino]ethyl-methylamino]ethyl-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate (PubChem CID 166047667) has the molecular formula C105H207N3O8 and a molecular weight of 1639.82 g/mol. Its IUPAC name is 9-[2-[2-[bis[9-(2-hexyldecanoyloxy)nonyl]amino]ethyl-methylamino]ethyl-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate.
| Compound Name | 9-[2-[2-[bis[9-(2-hexyldecanoyloxy)nonyl]amino]ethyl-methylamino]ethyl-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 166047667 |
| Molecular Formula | C105H207N3O8 |
| Molecular Weight | 1639.82 g/mol |
| Exact Mass | 1638.59 |
| IUPAC Name | 9-[2-[2-[bis[9-(2-hexyldecanoyloxy)nonyl]amino]ethyl-methylamino]ethyl-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCCCN(CCCCCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CCN(C)CCN(CCCCCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CCCCCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C105H207N3O8/c1-10-18-26-34-50-66-82-98(78-62-30-22-14-5)102(109)113-94-74-58-46-38-42-54-70-86-107(87-71-55-43-39-47-59-75-95-114-103(110)99(79-63-31-23-15-6)83-67-51-35-27-19-11-2)92-90-106(9)91-93-108(88-72-56-44-40-48-60-76-96-115-104(111)100(80-64-32-24-16-7)84-68-52-36-28-20-12-3)89-73-57-45-41-49-61-77-97-116-105(112)101(81-65-33-25-17-8)85-69-53-37-29-21-13-4/h98-101H,10-97H2,1-9H3 |
| InChIKey | XVDFJMWABWMYHC-UHFFFAOYSA-N |
| XLogP | 31.97 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 98 |
| Heavy Atoms | 116 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1639.82 |
| LogP ≤ 5 | 31.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|