C50H100N2O6 — CID 168892132
6-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl-[6-(2-pentyldecanoyloxy)hexyl]amino]hexyl 2-pentyldecanoate (PubChem CID 168892132) has the molecular formula C50H100N2O6 and a molecular weight of 825.36 g/mol. Its IUPAC name is 6-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl-[6-(2-pentyldecanoyloxy)hexyl]amino]hexyl 2-pentyldecanoate.
| Compound Name | 6-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl-[6-(2-pentyldecanoyloxy)hexyl]amino]hexyl 2-pentyldecanoate |
|---|---|
| PubChem CID | 168892132 |
| Molecular Formula | C50H100N2O6 |
| Molecular Weight | 825.36 g/mol |
| Exact Mass | 824.76 |
| IUPAC Name | 6-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethyl-[6-(2-pentyldecanoyloxy)hexyl]amino]hexyl 2-pentyldecanoate |
| SMILES | CCCCCCCCC(CCCCC)C(=O)OCCCCCCN(CCCCCCOC(=O)C(CCCCC)CCCCCCCC)CCOCCOCCN(C)C |
| InChI | InChI=1S/C50H100N2O6/c1-7-11-15-17-19-27-35-47(33-25-13-9-3)49(53)57-41-31-23-21-29-37-52(40-44-56-46-45-55-43-39-51(5)6)38-30-22-24-32-42-58-50(54)48(34-26-14-10-4)36-28-20-18-16-12-8-2/h47-48H,7-46H2,1-6H3 |
| InChIKey | RHYJXSZDQZYXGE-UHFFFAOYSA-N |
| XLogP | 12.98 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.36 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|