C57H113NO7 — CID 170389646
6-[3-[2-(2-ethoxyethoxy)ethoxy]propyl-[6-(2-octyldecanoyloxy)hexyl]amino]hexyl 2-octyldecanoate (PubChem CID 170389646) has the molecular formula C57H113NO7 and a molecular weight of 924.53 g/mol. Its IUPAC name is 6-[3-[2-(2-ethoxyethoxy)ethoxy]propyl-[6-(2-octyldecanoyloxy)hexyl]amino]hexyl 2-octyldecanoate.
| Compound Name | 6-[3-[2-(2-ethoxyethoxy)ethoxy]propyl-[6-(2-octyldecanoyloxy)hexyl]amino]hexyl 2-octyldecanoate |
|---|---|
| PubChem CID | 170389646 |
| Molecular Formula | C57H113NO7 |
| Molecular Weight | 924.53 g/mol |
| Exact Mass | 923.85 |
| IUPAC Name | 6-[3-[2-(2-ethoxyethoxy)ethoxy]propyl-[6-(2-octyldecanoyloxy)hexyl]amino]hexyl 2-octyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)C(=O)OCCCCCCN(CCCCCCOC(=O)C(CCCCCCCC)CCCCCCCC)CCCOCCOCCOCC |
| InChI | InChI=1S/C57H113NO7/c1-6-11-15-19-23-31-40-54(41-32-24-20-16-12-7-2)56(59)64-48-37-29-27-35-44-58(46-39-47-62-52-53-63-51-50-61-10-5)45-36-28-30-38-49-65-57(60)55(42-33-25-21-17-13-8-3)43-34-26-22-18-14-9-4/h54-55H,6-53H2,1-5H3 |
| InChIKey | FMBSVQYBGGKNMZ-UHFFFAOYSA-N |
| XLogP | 16.19 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.53 |
| LogP ≤ 5 | 16.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|