C26H53NO4 — CID 170023110
4-[4-hydroxybutyl(3-hydroxypropyl)amino]butyl 2-hexylnonanoate (PubChem CID 170023110) has the molecular formula C26H53NO4 and a molecular weight of 443.71 g/mol. Its IUPAC name is 4-[4-hydroxybutyl(3-hydroxypropyl)amino]butyl 2-hexylnonanoate.
| Compound Name | 4-[4-hydroxybutyl(3-hydroxypropyl)amino]butyl 2-hexylnonanoate |
|---|---|
| PubChem CID | 170023110 |
| Molecular Formula | C26H53NO4 |
| Molecular Weight | 443.71 g/mol |
| Exact Mass | 443.40 |
| IUPAC Name | 4-[4-hydroxybutyl(3-hydroxypropyl)amino]butyl 2-hexylnonanoate |
| SMILES | CCCCCCCC(CCCCCC)C(=O)OCCCCN(CCCO)CCCCO |
| InChI | InChI=1S/C26H53NO4/c1-3-5-7-9-11-18-25(17-10-8-6-4-2)26(30)31-24-15-13-20-27(21-16-23-29)19-12-14-22-28/h25,28-29H,3-24H2,1-2H3 |
| InChIKey | WETGDWVXRBUPHS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|