C40H79NO4 — CID 168878534
4-[(7-ethyl-6-oxopentadecyl)-(3-hydroxypropyl)amino]butyl 2-hexyldecanoate (PubChem CID 168878534) has the molecular formula C40H79NO4 and a molecular weight of 638.08 g/mol. Its IUPAC name is 4-[(7-ethyl-6-oxopentadecyl)-(3-hydroxypropyl)amino]butyl 2-hexyldecanoate.
| Compound Name | 4-[(7-ethyl-6-oxopentadecyl)-(3-hydroxypropyl)amino]butyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 168878534 |
| Molecular Formula | C40H79NO4 |
| Molecular Weight | 638.08 g/mol |
| Exact Mass | 637.60 |
| IUPAC Name | 4-[(7-ethyl-6-oxopentadecyl)-(3-hydroxypropyl)amino]butyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CC)C(=O)CCCCCN(CCCO)CCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C40H79NO4/c1-5-9-12-15-17-21-28-37(8-4)39(43)31-23-19-24-32-41(34-27-35-42)33-25-26-36-45-40(44)38(29-20-14-11-7-3)30-22-18-16-13-10-6-2/h37-38,42H,5-36H2,1-4H3 |
| InChIKey | KKHZMERYANRLNI-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.08 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|