C52H104N2O6 — CID 172572343
7-[2-[7-(2-hexyldecanoyloxy)heptyl-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]heptyl 2-hexyldecanoate (PubChem CID 172572343) has the molecular formula C52H104N2O6 and a molecular weight of 853.41 g/mol. Its IUPAC name is 7-[2-[7-(2-hexyldecanoyloxy)heptyl-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]heptyl 2-hexyldecanoate.
| Compound Name | 7-[2-[7-(2-hexyldecanoyloxy)heptyl-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]heptyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 172572343 |
| Molecular Formula | C52H104N2O6 |
| Molecular Weight | 853.41 g/mol |
| Exact Mass | 852.79 |
| IUPAC Name | 7-[2-[7-(2-hexyldecanoyloxy)heptyl-(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]heptyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCN(CCO)CCN(CCO)CCCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C52H104N2O6/c1-5-9-13-17-21-29-37-49(35-27-15-11-7-3)51(57)59-47-33-25-19-23-31-39-53(43-45-55)41-42-54(44-46-56)40-32-24-20-26-34-48-60-52(58)50(36-28-16-12-8-4)38-30-22-18-14-10-6-2/h49-50,55-56H,5-48H2,1-4H3 |
| InChIKey | QWLJTWHOQLUCOF-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.41 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|