C47H93NO5 — CID 177206570
6-[[(2R)-6-(2-hexyldecanoyloxy)-2-methylhexyl]-(2-hydroxyethyl)amino]hexyl 2-hexyldecanoate (PubChem CID 177206570) has the molecular formula C47H93NO5 and a molecular weight of 752.26 g/mol. Its IUPAC name is 6-[[(2R)-6-(2-hexyldecanoyloxy)-2-methylhexyl]-(2-hydroxyethyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[[(2R)-6-(2-hexyldecanoyloxy)-2-methylhexyl]-(2-hydroxyethyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 177206570 |
| Molecular Formula | C47H93NO5 |
| Molecular Weight | 752.26 g/mol |
| Exact Mass | 751.71 |
| IUPAC Name | 6-[[(2R)-6-(2-hexyldecanoyloxy)-2-methylhexyl]-(2-hydroxyethyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCO)C[C@H](C)CCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C47H93NO5/c1-6-10-14-18-20-26-35-44(33-24-16-12-8-3)46(50)52-40-30-23-22-29-37-48(38-39-49)42-43(5)32-28-31-41-53-47(51)45(34-25-17-13-9-4)36-27-21-19-15-11-7-2/h43-45,49H,6-42H2,1-5H3/t43-,44?,45?/m1/s1 |
| InChIKey | QYAVCLMAMMEECV-ZLPZTZTFSA-N |
| XLogP | 13.41 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.26 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|