C51H99NO8 — CID 178085034
4-[3-[4-(dipropylamino)butoxy]-2-[4-(2-hexyloctanoyloxy)butoxymethyl]-2-methyl-3-oxopropoxy]butyl 2-hexyloctanoate (PubChem CID 178085034) has the molecular formula C51H99NO8 and a molecular weight of 854.35 g/mol. Its IUPAC name is 4-[3-[4-(dipropylamino)butoxy]-2-[4-(2-hexyloctanoyloxy)butoxymethyl]-2-methyl-3-oxopropoxy]butyl 2-hexyloctanoate.
| Compound Name | 4-[3-[4-(dipropylamino)butoxy]-2-[4-(2-hexyloctanoyloxy)butoxymethyl]-2-methyl-3-oxopropoxy]butyl 2-hexyloctanoate |
|---|---|
| PubChem CID | 178085034 |
| Molecular Formula | C51H99NO8 |
| Molecular Weight | 854.35 g/mol |
| Exact Mass | 853.74 |
| IUPAC Name | 4-[3-[4-(dipropylamino)butoxy]-2-[4-(2-hexyloctanoyloxy)butoxymethyl]-2-methyl-3-oxopropoxy]butyl 2-hexyloctanoate |
| SMILES | CCCCCCC(CCCCCC)C(=O)OCCCCOCC(C)(COCCCCOC(=O)C(CCCCCC)CCCCCC)C(=O)OCCCCN(CCC)CCC |
| InChI | InChI=1S/C51H99NO8/c1-8-14-18-22-32-46(33-23-19-15-9-2)48(53)58-41-30-28-39-56-44-51(7,50(55)60-43-27-26-38-52(36-12-5)37-13-6)45-57-40-29-31-42-59-49(54)47(34-24-20-16-10-3)35-25-21-17-11-4/h46-47H,8-45H2,1-7H3 |
| InChIKey | CGIXFRGZQNFBDG-UHFFFAOYSA-N |
| XLogP | 13.23 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.35 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|