C48H99NO4 — CID 176680676
ethane;10-[ethyl(propyl)amino]decyl 2-butyloctanoate;heptyl 2-butyloctanoate (PubChem CID 176680676) has the molecular formula C48H99NO4 and a molecular weight of 754.32 g/mol. Its IUPAC name is ethane;10-[ethyl(propyl)amino]decyl 2-butyloctanoate;heptyl 2-butyloctanoate.
| Compound Name | ethane;10-[ethyl(propyl)amino]decyl 2-butyloctanoate;heptyl 2-butyloctanoate |
|---|---|
| PubChem CID | 176680676 |
| Molecular Formula | C48H99NO4 |
| Molecular Weight | 754.32 g/mol |
| Exact Mass | 753.76 |
| IUPAC Name | ethane;10-[ethyl(propyl)amino]decyl 2-butyloctanoate;heptyl 2-butyloctanoate |
| SMILES | CC.CCCCCCC(CCCC)C(=O)OCCCCCCCCCCN(CC)CCC.CCCCCCCOC(=O)C(CCCC)CCCCCC |
| InChI | InChI=1S/C27H55NO2.C19H38O2.C2H6/c1-5-9-11-18-22-26(21-10-6-2)27(29)30-25-20-17-15-13-12-14-16-19-24-28(8-4)23-7-3;1-4-7-10-12-14-17-21-19(20)18(15-9-6-3)16-13-11-8-5-2;1-2/h26H,5-25H2,1-4H3;18H,4-17H2,1-3H3;1-2H3 |
| InChIKey | XGCQJOJTERAVIV-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.32 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|