C36H71NO3 — CID 155719772
9-[8-oxooctyl(propyl)amino]nonyl 2-hexyldecanoate (PubChem CID 155719772) has the molecular formula C36H71NO3 and a molecular weight of 565.97 g/mol. Its IUPAC name is 9-[8-oxooctyl(propyl)amino]nonyl 2-hexyldecanoate.
| Compound Name | 9-[8-oxooctyl(propyl)amino]nonyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 155719772 |
| Molecular Formula | C36H71NO3 |
| Molecular Weight | 565.97 g/mol |
| Exact Mass | 565.54 |
| IUPAC Name | 9-[8-oxooctyl(propyl)amino]nonyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCCCN(CCC)CCCCCCCC=O |
| InChI | InChI=1S/C36H71NO3/c1-4-7-9-11-17-23-29-35(28-22-10-8-5-2)36(39)40-34-27-21-16-12-13-18-24-31-37(30-6-3)32-25-19-14-15-20-26-33-38/h33,35H,4-32,34H2,1-3H3 |
| InChIKey | BTUFWDZFGJXMJO-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.97 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|