C51H101NO5 — CID 170679983
[7-[4-(dipropylamino)butyl]-7-hydroxy-13-(2-pentylnonanoyloxy)tridecyl] 2-pentylnonanoate (PubChem CID 170679983) has the molecular formula C51H101NO5 and a molecular weight of 808.37 g/mol. Its IUPAC name is [7-[4-(dipropylamino)butyl]-7-hydroxy-13-(2-pentylnonanoyloxy)tridecyl] 2-pentylnonanoate.
| Compound Name | [7-[4-(dipropylamino)butyl]-7-hydroxy-13-(2-pentylnonanoyloxy)tridecyl] 2-pentylnonanoate |
|---|---|
| PubChem CID | 170679983 |
| Molecular Formula | C51H101NO5 |
| Molecular Weight | 808.37 g/mol |
| Exact Mass | 807.77 |
| IUPAC Name | [7-[4-(dipropylamino)butyl]-7-hydroxy-13-(2-pentylnonanoyloxy)tridecyl] 2-pentylnonanoate |
| SMILES | CCCCCCCC(CCCCC)C(=O)OCCCCCCC(O)(CCCCCCOC(=O)C(CCCCC)CCCCCCC)CCCCN(CCC)CCC |
| InChI | InChI=1S/C51H101NO5/c1-7-13-17-19-27-37-47(35-25-15-9-3)49(53)56-45-33-23-21-29-39-51(55,41-31-32-44-52(42-11-5)43-12-6)40-30-22-24-34-46-57-50(54)48(36-26-16-10-4)38-28-20-18-14-8-2/h47-48,55H,7-46H2,1-6H3 |
| InChIKey | YKAMKBLRJSLVLB-UHFFFAOYSA-N |
| XLogP | 15.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.37 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|