C55H109NO5 — CID 170679967
[7-[4-(dipropylamino)butyl]-13-(2-heptylnonanoyloxy)-7-hydroxytridecyl] 2-heptylnonanoate (PubChem CID 170679967) has the molecular formula C55H109NO5 and a molecular weight of 864.48 g/mol. Its IUPAC name is [7-[4-(dipropylamino)butyl]-13-(2-heptylnonanoyloxy)-7-hydroxytridecyl] 2-heptylnonanoate.
| Compound Name | [7-[4-(dipropylamino)butyl]-13-(2-heptylnonanoyloxy)-7-hydroxytridecyl] 2-heptylnonanoate |
|---|---|
| PubChem CID | 170679967 |
| Molecular Formula | C55H109NO5 |
| Molecular Weight | 864.48 g/mol |
| Exact Mass | 863.83 |
| IUPAC Name | [7-[4-(dipropylamino)butyl]-13-(2-heptylnonanoyloxy)-7-hydroxytridecyl] 2-heptylnonanoate |
| SMILES | CCCCCCCC(CCCCCCC)C(=O)OCCCCCCC(O)(CCCCCCOC(=O)C(CCCCCCC)CCCCCCC)CCCCN(CCC)CCC |
| InChI | InChI=1S/C55H109NO5/c1-7-13-17-21-29-39-51(40-30-22-18-14-8-2)53(57)60-49-37-27-25-33-43-55(59,45-35-36-48-56(46-11-5)47-12-6)44-34-26-28-38-50-61-54(58)52(41-31-23-19-15-9-3)42-32-24-20-16-10-4/h51-52,59H,7-50H2,1-6H3 |
| InChIKey | DAJCFRMKYNKJDW-UHFFFAOYSA-N |
| XLogP | 16.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.48 |
| LogP ≤ 5 | 16.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|