C48H92F3NO4 — CID 164814048
6-[6-(2-hexyldecanoyloxy)hexyl-(4,4,4-trifluorobutyl)amino]hexyl 2-hexyldecanoate (PubChem CID 164814048) has the molecular formula C48H92F3NO4 and a molecular weight of 804.26 g/mol. Its IUPAC name is 6-[6-(2-hexyldecanoyloxy)hexyl-(4,4,4-trifluorobutyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[6-(2-hexyldecanoyloxy)hexyl-(4,4,4-trifluorobutyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 164814048 |
| Molecular Formula | C48H92F3NO4 |
| Molecular Weight | 804.26 g/mol |
| Exact Mass | 803.70 |
| IUPAC Name | 6-[6-(2-hexyldecanoyloxy)hexyl-(4,4,4-trifluorobutyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CCCC(F)(F)F |
| InChI | InChI=1S/C48H92F3NO4/c1-5-9-13-17-19-27-36-44(34-25-15-11-7-3)46(53)55-42-31-23-21-29-39-52(41-33-38-48(49,50)51)40-30-22-24-32-43-56-47(54)45(35-26-16-12-8-4)37-28-20-18-14-10-6-2/h44-45H,5-43H2,1-4H3 |
| InChIKey | LPMAHTVQXOUMKE-UHFFFAOYSA-N |
| XLogP | 15.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.26 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|