C43H85NO5 — CID 170679957
[13-(2-butylhexanoyloxy)-7-[4-(dipropylamino)butyl]-7-hydroxytridecyl] 2-butylhexanoate (PubChem CID 170679957) has the molecular formula C43H85NO5 and a molecular weight of 696.15 g/mol. Its IUPAC name is [13-(2-butylhexanoyloxy)-7-[4-(dipropylamino)butyl]-7-hydroxytridecyl] 2-butylhexanoate.
| Compound Name | [13-(2-butylhexanoyloxy)-7-[4-(dipropylamino)butyl]-7-hydroxytridecyl] 2-butylhexanoate |
|---|---|
| PubChem CID | 170679957 |
| Molecular Formula | C43H85NO5 |
| Molecular Weight | 696.15 g/mol |
| Exact Mass | 695.64 |
| IUPAC Name | [13-(2-butylhexanoyloxy)-7-[4-(dipropylamino)butyl]-7-hydroxytridecyl] 2-butylhexanoate |
| SMILES | CCCCC(CCCC)C(=O)OCCCCCCC(O)(CCCCCCOC(=O)C(CCCC)CCCC)CCCCN(CCC)CCC |
| InChI | InChI=1S/C43H85NO5/c1-7-13-27-39(28-14-8-2)41(45)48-37-25-19-17-21-31-43(47,33-23-24-36-44(34-11-5)35-12-6)32-22-18-20-26-38-49-42(46)40(29-15-9-3)30-16-10-4/h39-40,47H,7-38H2,1-6H3 |
| InChIKey | JHDQTLDALQETBX-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.15 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|