C28H58N2O2 — CID 163299451
6-[4-aminobutyl(ethyl)amino]hexyl 2-hexyldecanoate (PubChem CID 163299451) has the molecular formula C28H58N2O2 and a molecular weight of 454.78 g/mol. Its IUPAC name is 6-[4-aminobutyl(ethyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[4-aminobutyl(ethyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 163299451 |
| Molecular Formula | C28H58N2O2 |
| Molecular Weight | 454.78 g/mol |
| Exact Mass | 454.45 |
| IUPAC Name | 6-[4-aminobutyl(ethyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CC)CCCCN |
| InChI | InChI=1S/C28H58N2O2/c1-4-7-9-11-12-16-22-27(21-15-10-8-5-2)28(31)32-26-20-14-13-18-24-30(6-3)25-19-17-23-29/h27H,4-26,29H2,1-3H3 |
| InChIKey | QPWFSSJWRYYVBW-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.78 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|