About 5-bromopentyl 2-octyldecanoate
5-bromopentyl 2-octyldecanoate (PubChem CID 172946114) has the molecular formula C23H45BrO2
and a molecular weight of 433.52 g/mol. Its IUPAC name is 5-bromopentyl 2-octyldecanoate.
Molecular Properties
| Compound Name | 5-bromopentyl 2-octyldecanoate |
| PubChem CID | 172946114 |
| Molecular Formula | C23H45BrO2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 5-bromopentyl 2-octyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)C(=O)OCCCCCBr |
| InChI | InChI=1S/C23H45BrO2/c1-3-5-7-9-11-14-18-22(19-15-12-10-8-6-4-2)23(25)26-21-17-13-16-20-24/h22H,3-21H2,1-2H3 |
| InChIKey | DIPQWTYEKBEHHI-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromopentyl 2-octyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopentyl 2-octyldecanoate?
The IUPAC name of 5-bromopentyl 2-octyldecanoate (CID 172946114) is 5-bromopentyl 2-octyldecanoate.
What is the SMILES notation for 5-bromopentyl 2-octyldecanoate?
The canonical SMILES for 5-bromopentyl 2-octyldecanoate is CCCCCCCCC(CCCCCCCC)C(=O)OCCCCCBr.
What is the InChIKey of 5-bromopentyl 2-octyldecanoate?
The InChIKey is DIPQWTYEKBEHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H45BrO2/c1-3-5-7-9-11-14-18-22(19-15-12-10-8-6-4-2)23(25)26-21-17-13-16-20-24/h22H,3-21H2,1-2H3.
What are the key properties of 5-bromopentyl 2-octyldecanoate?
5-bromopentyl 2-octyldecanoate has a molecular weight of 433.52 g/mol, XLogP of 8.21, 20 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopentyl 2-octyldecanoate is sourced from PubChem (CID 172946114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).