C50H103NO6Si — CID 170743007
6-[[6-[dimethyl(octoxy)silyl]oxy-6-octoxyhexyl]-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate (PubChem CID 170743007) has the molecular formula C50H103NO6Si and a molecular weight of 842.46 g/mol. Its IUPAC name is 6-[[6-[dimethyl(octoxy)silyl]oxy-6-octoxyhexyl]-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[[6-[dimethyl(octoxy)silyl]oxy-6-octoxyhexyl]-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 170743007 |
| Molecular Formula | C50H103NO6Si |
| Molecular Weight | 842.46 g/mol |
| Exact Mass | 841.76 |
| IUPAC Name | 6-[[6-[dimethyl(octoxy)silyl]oxy-6-octoxyhexyl]-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCOC(CCCCCN(CCCCO)CCCCCCOC(=O)C(CCCCCC)CCCCCCCC)O[Si](C)(C)OCCCCCCCC |
| InChI | InChI=1S/C50H103NO6Si/c1-7-11-15-19-22-29-39-48(38-28-18-14-10-4)50(53)55-46-36-26-23-31-41-51(43-33-34-44-52)42-32-27-30-40-49(54-45-35-24-20-16-12-8-2)57-58(5,6)56-47-37-25-21-17-13-9-3/h48-49,52H,7-47H2,1-6H3 |
| InChIKey | PLZWSYMMGGACBZ-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.46 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|