C51H105NO6Si — CID 170743343
6-[6-[dimethyl(1-octoxynonoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate (PubChem CID 170743343) has the molecular formula C51H105NO6Si and a molecular weight of 856.49 g/mol. Its IUPAC name is 6-[6-[dimethyl(1-octoxynonoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate.
| Compound Name | 6-[6-[dimethyl(1-octoxynonoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 170743343 |
| Molecular Formula | C51H105NO6Si |
| Molecular Weight | 856.49 g/mol |
| Exact Mass | 855.77 |
| IUPAC Name | 6-[6-[dimethyl(1-octoxynonoxy)silyl]oxyhexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate |
| SMILES | CCCCCCCCOC(CCCCCCCC)O[Si](C)(C)OCCCCCCN(CCCCO)CCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C51H105NO6Si/c1-7-11-15-19-22-30-40-49(39-29-18-14-10-4)51(54)56-47-37-27-24-32-42-52(44-34-35-45-53)43-33-25-28-38-48-57-59(5,6)58-50(41-31-23-20-16-12-8-2)55-46-36-26-21-17-13-9-3/h49-50,53H,7-48H2,1-6H3 |
| InChIKey | FJWBUXTWRKHWCZ-UHFFFAOYSA-N |
| XLogP | 15.25 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.49 |
| LogP ≤ 5 | 15.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|